C28H28N2O3 — CID 42785450
1-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 42785450) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42785450 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-(3,4-dimethylphenyl)-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cc(C(=O)Nc3ccc(C)c(C)c3)c2C)cc1OC |
| InChI | InChI=1S/C28H28N2O3/c1-18-11-12-22(15-19(18)2)29-28(31)24-17-25(21-9-7-6-8-10-21)30(20(24)3)23-13-14-26(32-4)27(16-23)33-5/h6-17H,1-5H3,(H,29,31) |
| InChIKey | GRLBFHPUCIRQTG-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|