C22H24N2O3 — CID 26695119
N-(3,4-dimethoxyphenyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide (PubChem CID 26695119) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 26695119 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2,5-dimethyl-1-(3-methylphenyl)pyrrole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(C)n(-c3cccc(C)c3)c2C)cc1OC |
| InChI | InChI=1S/C22H24N2O3/c1-14-7-6-8-18(11-14)24-15(2)12-19(16(24)3)22(25)23-17-9-10-20(26-4)21(13-17)27-5/h6-13H,1-5H3,(H,23,25) |
| InChIKey | RWIPXQJLGNABIG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|