C24H25NO3S — CID 46488801
N-(3,3-diphenylpropyl)-4-methyl-3-methylsulfonylbenzamide (PubChem CID 46488801) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4-methyl-3-methylsulfonylbenzamide.
| Compound Name | N-(3,3-diphenylpropyl)-4-methyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 46488801 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4-methyl-3-methylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCC(c2ccccc2)c2ccccc2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C24H25NO3S/c1-18-13-14-21(17-23(18)29(2,27)28)24(26)25-16-15-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17,22H,15-16H2,1-2H3,(H,25,26) |
| InChIKey | MWQCERNGFANRKL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |