C16H23NO3S2 — CID 47047129
N-(2-cyclopentylsulfanylethyl)-4-methyl-3-methylsulfonylbenzamide (PubChem CID 47047129) has the molecular formula C16H23NO3S2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-4-methyl-3-methylsulfonylbenzamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-4-methyl-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 47047129 |
| Molecular Formula | C16H23NO3S2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-4-methyl-3-methylsulfonylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCSC2CCCC2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C16H23NO3S2/c1-12-7-8-13(11-15(12)22(2,19)20)16(18)17-9-10-21-14-5-3-4-6-14/h7-8,11,14H,3-6,9-10H2,1-2H3,(H,17,18) |
| InChIKey | CISKAWSOQLPCOR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|