C15H23ClN2O3S — CID 119602106
N-[2-(aminomethyl)cyclopentyl]-4-methyl-3-methylsulfonylbenzamide;hydrochloride (PubChem CID 119602106) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-methyl-3-methylsulfonylbenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-methyl-3-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119602106 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-methyl-3-methylsulfonylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NC2CCCC2CN)cc1S(C)(=O)=O.Cl |
| InChI | InChI=1S/C15H22N2O3S.ClH/c1-10-6-7-11(8-14(10)21(2,19)20)15(18)17-13-5-3-4-12(13)9-16;/h6-8,12-13H,3-5,9,16H2,1-2H3,(H,17,18);1H |
| InChIKey | XOEZLVQRVKEPKK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |