C15H22ClN3O4S — CID 119602335
N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride (PubChem CID 119602335) has the molecular formula C15H22ClN3O4S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119602335 |
| Molecular Formula | C15H22ClN3O4S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1ccc(S(=O)(=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C15H21N3O4S.ClH/c16-8-11-2-1-3-13(11)18-15(20)10-4-6-12(7-5-10)23(21,22)9-14(17)19;/h4-7,11,13H,1-3,8-9,16H2,(H2,17,19)(H,18,20);1H |
| InChIKey | LPZIPEAFNFXSKS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |