C24H32N2O3S2 — CID 3920439
N-(2-cyclohexylsulfanylethyl)-3-[(3,4-dimethylphenyl)sulfamoyl]-4-methylbenzamide (PubChem CID 3920439) has the molecular formula C24H32N2O3S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is N-(2-cyclohexylsulfanylethyl)-3-[(3,4-dimethylphenyl)sulfamoyl]-4-methylbenzamide.
| Compound Name | N-(2-cyclohexylsulfanylethyl)-3-[(3,4-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 3920439 |
| Molecular Formula | C24H32N2O3S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-(2-cyclohexylsulfanylethyl)-3-[(3,4-dimethylphenyl)sulfamoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C(=O)NCCSC3CCCCC3)ccc2C)cc1C |
| InChI | InChI=1S/C24H32N2O3S2/c1-17-10-12-21(15-19(17)3)26-31(28,29)23-16-20(11-9-18(23)2)24(27)25-13-14-30-22-7-5-4-6-8-22/h9-12,15-16,22,26H,4-8,13-14H2,1-3H3,(H,25,27) |
| InChIKey | DKNACXZXTSVLID-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|