C21H25ClN2O3S2 — CID 100578773
4-chloro-N-(2-cyclopentylsulfanylethyl)-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 100578773) has the molecular formula C21H25ClN2O3S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is 4-chloro-N-(2-cyclopentylsulfanylethyl)-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | 4-chloro-N-(2-cyclopentylsulfanylethyl)-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 100578773 |
| Molecular Formula | C21H25ClN2O3S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 4-chloro-N-(2-cyclopentylsulfanylethyl)-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)NCCSC3CCCC3)ccc2Cl)c1 |
| InChI | InChI=1S/C21H25ClN2O3S2/c1-15-5-4-6-17(13-15)24-29(26,27)20-14-16(9-10-19(20)22)21(25)23-11-12-28-18-7-2-3-8-18/h4-6,9-10,13-14,18,24H,2-3,7-8,11-12H2,1H3,(H,23,25) |
| InChIKey | JNHDSYBQUNVUBU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|