C21H23ClN2O3S — CID 126411292
N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-[(3-methylphenyl)sulfamoyl]benzamide (PubChem CID 126411292) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-[(3-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-[(3-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 126411292 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-4-chloro-3-[(3-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2cc(C(=O)N[C@H]3C[C@H]4CC[C@H]3C4)ccc2Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-13-3-2-4-17(9-13)24-28(26,27)20-12-16(7-8-18(20)22)21(25)23-19-11-14-5-6-15(19)10-14/h2-4,7-9,12,14-15,19,24H,5-6,10-11H2,1H3,(H,23,25)/t14-,15-,19-/m0/s1 |
| InChIKey | DOKATSZIRGVLIM-DOXZYTNZSA-N |
| XLogP | 4.37 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |