C21H25ClN2O3S2 — CID 38014027
5-(benzenesulfonamido)-2-chloro-N-(2-cyclohexylsulfanylethyl)benzamide (PubChem CID 38014027) has the molecular formula C21H25ClN2O3S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-chloro-N-(2-cyclohexylsulfanylethyl)benzamide.
| Compound Name | 5-(benzenesulfonamido)-2-chloro-N-(2-cyclohexylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 38014027 |
| Molecular Formula | C21H25ClN2O3S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5-(benzenesulfonamido)-2-chloro-N-(2-cyclohexylsulfanylethyl)benzamide |
| SMILES | O=C(NCCSC1CCCCC1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C21H25ClN2O3S2/c22-20-12-11-16(24-29(26,27)18-9-5-2-6-10-18)15-19(20)21(25)23-13-14-28-17-7-3-1-4-8-17/h2,5-6,9-12,15,17,24H,1,3-4,7-8,13-14H2,(H,23,25) |
| InChIKey | OPRGEXIXDWKXDV-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|