C22H21ClN2O3S2 — CID 30400846
5-(benzenesulfonamido)-N-(2-benzylsulfanylethyl)-2-chlorobenzamide (PubChem CID 30400846) has the molecular formula C22H21ClN2O3S2 and a molecular weight of 461.01 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-N-(2-benzylsulfanylethyl)-2-chlorobenzamide.
| Compound Name | 5-(benzenesulfonamido)-N-(2-benzylsulfanylethyl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 30400846 |
| Molecular Formula | C22H21ClN2O3S2 |
| Molecular Weight | 461.01 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 5-(benzenesulfonamido)-N-(2-benzylsulfanylethyl)-2-chlorobenzamide |
| SMILES | O=C(NCCSCc1ccccc1)c1cc(NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H21ClN2O3S2/c23-21-12-11-18(25-30(27,28)19-9-5-2-6-10-19)15-20(21)22(26)24-13-14-29-16-17-7-3-1-4-8-17/h1-12,15,25H,13-14,16H2,(H,24,26) |
| InChIKey | VASXHMWYVAWGCC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.01 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|