C23H24N2O3S2 — CID 126414764
4-(benzenesulfonamido)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 126414764) has the molecular formula C23H24N2O3S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 126414764 |
| Molecular Formula | C23H24N2O3S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | Cc1cccc(CSCCNC(=O)c2ccc(NS(=O)(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H24N2O3S2/c1-18-6-5-7-19(16-18)17-29-15-14-24-23(26)20-10-12-21(13-11-20)25-30(27,28)22-8-3-2-4-9-22/h2-13,16,25H,14-15,17H2,1H3,(H,24,26) |
| InChIKey | WYOKLVRZPKLNJQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|