C22H29N2O2S+ — CID 2288627
N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide (PubChem CID 2288627) has the molecular formula C22H29N2O2S+ and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide.
| Compound Name | N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 2288627 |
| Molecular Formula | C22H29N2O2S+ |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]-4-(morpholin-4-ium-4-ylmethyl)benzamide |
| SMILES | Cc1cccc(CSCCNC(=O)c2ccc(C[NH+]3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H28N2O2S/c1-18-3-2-4-20(15-18)17-27-14-9-23-22(25)21-7-5-19(6-8-21)16-24-10-12-26-13-11-24/h2-8,15H,9-14,16-17H2,1H3,(H,23,25)/p+1 |
| InChIKey | CKGYFUFCSQKILU-UHFFFAOYSA-O |
| XLogP | 2.07 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|