C14H13Cl2NO2S — CID 126180652
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]furan-2-carboxamide (PubChem CID 126180652) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 126180652 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C14H13Cl2NO2S/c15-11-4-3-10(8-12(11)16)9-20-7-5-17-14(18)13-2-1-6-19-13/h1-4,6,8H,5,7,9H2,(H,17,18) |
| InChIKey | RPGNLXAIYZCXRV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|