C19H21Cl2NOS2 — CID 92680272
2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 92680272) has the molecular formula C19H21Cl2NOS2 and a molecular weight of 414.42 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 92680272 |
| Molecular Formula | C19H21Cl2NOS2 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(CSCCNC(=O)CSCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H21Cl2NOS2/c1-14-2-4-15(5-3-14)11-24-9-8-22-19(23)13-25-12-16-6-7-17(20)18(21)10-16/h2-7,10H,8-9,11-13H2,1H3,(H,22,23) |
| InChIKey | GTUZGNVBFFQLKO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|