C24H23Cl3N2O3S2 — CID 43881370
2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 43881370) has the molecular formula C24H23Cl3N2O3S2 and a molecular weight of 557.95 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 43881370 |
| Molecular Formula | C24H23Cl3N2O3S2 |
| Molecular Weight | 557.95 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | 2-(3-chloro-N-(4-methylphenyl)sulfonylanilino)-N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSCc2ccc(Cl)c(Cl)c2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O3S2/c1-17-5-8-21(9-6-17)34(31,32)29(20-4-2-3-19(25)14-20)15-24(30)28-11-12-33-16-18-7-10-22(26)23(27)13-18/h2-10,13-14H,11-12,15-16H2,1H3,(H,28,30) |
| InChIKey | UQOLQPBIXXXXBL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.95 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|