C19H21ClFNOS2 — CID 3899059
2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 3899059) has the molecular formula C19H21ClFNOS2 and a molecular weight of 397.97 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 3899059 |
| Molecular Formula | C19H21ClFNOS2 |
| Molecular Weight | 397.97 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1ccc(CSCCNC(=O)CSCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C19H21ClFNOS2/c1-14-5-7-15(8-6-14)11-24-10-9-22-19(23)13-25-12-16-17(20)3-2-4-18(16)21/h2-8H,9-13H2,1H3,(H,22,23) |
| InChIKey | DKJQTPLJQWZEMU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|