C19H22BrNOS2 — CID 2972921
2-[(4-bromophenyl)methylsulfanyl]-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 2972921) has the molecular formula C19H22BrNOS2 and a molecular weight of 424.43 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 2972921 |
| Molecular Formula | C19H22BrNOS2 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-N-[2-[(3-methylphenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | Cc1cccc(CSCCNC(=O)CSCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C19H22BrNOS2/c1-15-3-2-4-17(11-15)13-23-10-9-21-19(22)14-24-12-16-5-7-18(20)8-6-16/h2-8,11H,9-10,12-14H2,1H3,(H,21,22) |
| InChIKey | SBGRFDVJWHNLLW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|