C19H23NOS2 — CID 7488695
N-(2-benzylsulfanylethyl)-2-(2,5-dimethylphenyl)sulfanylacetamide (PubChem CID 7488695) has the molecular formula C19H23NOS2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(2,5-dimethylphenyl)sulfanylacetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(2,5-dimethylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7488695 |
| Molecular Formula | C19H23NOS2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(2,5-dimethylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(C)c(SCC(=O)NCCSCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NOS2/c1-15-8-9-16(2)18(12-15)23-14-19(21)20-10-11-22-13-17-6-4-3-5-7-17/h3-9,12H,10-11,13-14H2,1-2H3,(H,20,21) |
| InChIKey | YMGHRGXUXOPWSJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|