C17H17Cl2NOS2 — CID 7489579
N-(2-benzylsulfanylethyl)-2-(2,6-dichlorophenyl)sulfanylacetamide (PubChem CID 7489579) has the molecular formula C17H17Cl2NOS2 and a molecular weight of 386.37 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2-(2,6-dichlorophenyl)sulfanylacetamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2-(2,6-dichlorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7489579 |
| Molecular Formula | C17H17Cl2NOS2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2-(2,6-dichlorophenyl)sulfanylacetamide |
| SMILES | O=C(CSc1c(Cl)cccc1Cl)NCCSCc1ccccc1 |
| InChI | InChI=1S/C17H17Cl2NOS2/c18-14-7-4-8-15(19)17(14)23-12-16(21)20-9-10-22-11-13-5-2-1-3-6-13/h1-8H,9-12H2,(H,20,21) |
| InChIKey | QJMJYTYKUAVZQE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|