C15H22N2O3S — CID 167866436
(2S)-2-amino-5-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]pentanoic acid (PubChem CID 167866436) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is (2S)-2-amino-5-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 167866436 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2S)-2-amino-5-[[2-[(3-methylphenyl)methylsulfanyl]acetyl]amino]pentanoic acid |
| SMILES | Cc1cccc(CSCC(=O)NCCC[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-11-4-2-5-12(8-11)9-21-10-14(18)17-7-3-6-13(16)15(19)20/h2,4-5,8,13H,3,6-7,9-10,16H2,1H3,(H,17,18)(H,19,20)/t13-/m0/s1 |
| InChIKey | XWMXSCVSPJFYTH-ZDUSSCGKSA-N |
| XLogP | 1.54 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|