C15H20F3NO2S — CID 86929058
2-[(3-methylphenyl)methylsulfanyl]-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide (PubChem CID 86929058) has the molecular formula C15H20F3NO2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methylsulfanyl]-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide.
| Compound Name | 2-[(3-methylphenyl)methylsulfanyl]-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 86929058 |
| Molecular Formula | C15H20F3NO2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(3-methylphenyl)methylsulfanyl]-N-[3-(2,2,2-trifluoroethoxy)propyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)NCCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H20F3NO2S/c1-12-4-2-5-13(8-12)9-22-10-14(20)19-6-3-7-21-11-15(16,17)18/h2,4-5,8H,3,6-7,9-11H2,1H3,(H,19,20) |
| InChIKey | SVCJJUMOGWUQGU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|