C13H16F3NOS — CID 78786742
N-propyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]acetamide (PubChem CID 78786742) has the molecular formula C13H16F3NOS and a molecular weight of 291.34 g/mol. Its IUPAC name is N-propyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]acetamide.
| Compound Name | N-propyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 78786742 |
| Molecular Formula | C13H16F3NOS |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-propyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]acetamide |
| SMILES | CCCNC(=O)CSCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3NOS/c1-2-6-17-12(18)9-19-8-10-4-3-5-11(7-10)13(14,15)16/h3-5,7H,2,6,8-9H2,1H3,(H,17,18) |
| InChIKey | VYKDXIHAJRPXDF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |