C13H18ClF3N2O — CID 119508394
N-[2-(ethylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride (PubChem CID 119508394) has the molecular formula C13H18ClF3N2O and a molecular weight of 310.75 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119508394 |
| Molecular Formula | C13H18ClF3N2O |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
| SMILES | CCNCCNC(=O)Cc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C13H17F3N2O.ClH/c1-2-17-6-7-18-12(19)9-10-4-3-5-11(8-10)13(14,15)16;/h3-5,8,17H,2,6-7,9H2,1H3,(H,18,19);1H |
| InChIKey | CGUNNRNFMFZDDT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|