C13H18ClF3N2 — CID 45266047
N,N'-diethyl-2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride (PubChem CID 45266047) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is N,N'-diethyl-2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride.
| Compound Name | N,N'-diethyl-2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 45266047 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N,N'-diethyl-2-[3-(trifluoromethyl)phenyl]ethanimidamide;hydrochloride |
| SMILES | CC/N=C(/Cc1cccc(C(F)(F)F)c1)NCC.Cl |
| InChI | InChI=1S/C13H17F3N2.ClH/c1-3-17-12(18-4-2)9-10-6-5-7-11(8-10)13(14,15)16;/h5-8H,3-4,9H2,1-2H3,(H,17,18);1H |
| InChIKey | ANXYVZRMSHOQNP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|