C18H20ClF3N2O — CID 119440375
N-[2-(ethylaminomethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride (PubChem CID 119440375) has the molecular formula C18H20ClF3N2O and a molecular weight of 372.82 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119440375 |
| Molecular Formula | C18H20ClF3N2O |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)Cc1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C18H19F3N2O.ClH/c1-2-22-12-14-7-3-4-9-16(14)23-17(24)11-13-6-5-8-15(10-13)18(19,20)21;/h3-10,22H,2,11-12H2,1H3,(H,23,24);1H |
| InChIKey | KRCPIWUAURSNAI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |