C15H10Br2F3NO — CID 67184957
N-(2,3-dibromophenyl)-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 67184957) has the molecular formula C15H10Br2F3NO and a molecular weight of 437.05 g/mol. Its IUPAC name is N-(2,3-dibromophenyl)-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-(2,3-dibromophenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67184957 |
| Molecular Formula | C15H10Br2F3NO |
| Molecular Weight | 437.05 g/mol |
| Exact Mass | 434.91 |
| IUPAC Name | N-(2,3-dibromophenyl)-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)Nc1cccc(Br)c1Br |
| InChI | InChI=1S/C15H10Br2F3NO/c16-11-5-2-6-12(14(11)17)21-13(22)8-9-3-1-4-10(7-9)15(18,19)20/h1-7H,8H2,(H,21,22) |
| InChIKey | JQROVWSDXIBCDB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.05 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |