C20H20F3NO2 — CID 149202431
N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]pentanamide (PubChem CID 149202431) has the molecular formula C20H20F3NO2 and a molecular weight of 363.38 g/mol. Its IUPAC name is N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]pentanamide.
| Compound Name | N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 149202431 |
| Molecular Formula | C20H20F3NO2 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccccc1C(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3NO2/c1-2-3-11-19(26)24-17-10-5-4-9-16(17)18(25)13-14-7-6-8-15(12-14)20(21,22)23/h4-10,12H,2-3,11,13H2,1H3,(H,24,26) |
| InChIKey | XEYMKAFOPSROHZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |