C24H17F3N2O2 — CID 149040508
N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]-3H-indole-4-carboxamide (PubChem CID 149040508) has the molecular formula C24H17F3N2O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]-3H-indole-4-carboxamide.
| Compound Name | N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]-3H-indole-4-carboxamide |
|---|---|
| PubChem CID | 149040508 |
| Molecular Formula | C24H17F3N2O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]-3H-indole-4-carboxamide |
| SMILES | O=C(Cc1cccc(C(F)(F)F)c1)c1ccccc1NC(=O)c1cccc2c1CC=N2 |
| InChI | InChI=1S/C24H17F3N2O2/c25-24(26,27)16-6-3-5-15(13-16)14-22(30)19-7-1-2-9-21(19)29-23(31)18-8-4-10-20-17(18)11-12-28-20/h1-10,12-13H,11,14H2,(H,29,31) |
| InChIKey | QHMMBXXXGZASFE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |