C26H21NO2S — CID 157352510
2-methyl-N-[2-[2-(3-thiophen-2-ylphenyl)acetyl]phenyl]benzamide (PubChem CID 157352510) has the molecular formula C26H21NO2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(3-thiophen-2-ylphenyl)acetyl]phenyl]benzamide.
| Compound Name | 2-methyl-N-[2-[2-(3-thiophen-2-ylphenyl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 157352510 |
| Molecular Formula | C26H21NO2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-methyl-N-[2-[2-(3-thiophen-2-ylphenyl)acetyl]phenyl]benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccccc1C(=O)Cc1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C26H21NO2S/c1-18-8-2-3-11-21(18)26(29)27-23-13-5-4-12-22(23)24(28)17-19-9-6-10-20(16-19)25-14-7-15-30-25/h2-16H,17H2,1H3,(H,27,29) |
| InChIKey | BHRVVUHFRHVVTA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |