C25H23NO2 — CID 159369653
2-methyl-N-[2-[2-[3-[(Z)-prop-1-enyl]phenyl]acetyl]phenyl]benzamide (PubChem CID 159369653) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[3-[(Z)-prop-1-enyl]phenyl]acetyl]phenyl]benzamide.
| Compound Name | 2-methyl-N-[2-[2-[3-[(Z)-prop-1-enyl]phenyl]acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 159369653 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-methyl-N-[2-[2-[3-[(Z)-prop-1-enyl]phenyl]acetyl]phenyl]benzamide |
| SMILES | C/C=C\c1cccc(CC(=O)c2ccccc2NC(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C25H23NO2/c1-3-9-19-11-8-12-20(16-19)17-24(27)22-14-6-7-15-23(22)26-25(28)21-13-5-4-10-18(21)2/h3-16H,17H2,1-2H3,(H,26,28)/b9-3- |
| InChIKey | LJOSJNWTPFMBKA-OQFOIZHKSA-N |
| XLogP | 5.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |