C24H23NO2S — CID 158896086
2-ethylsulfanyl-N-[2-[2-(3-methylphenyl)acetyl]phenyl]benzamide (PubChem CID 158896086) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-ethylsulfanyl-N-[2-[2-(3-methylphenyl)acetyl]phenyl]benzamide.
| Compound Name | 2-ethylsulfanyl-N-[2-[2-(3-methylphenyl)acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 158896086 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-ethylsulfanyl-N-[2-[2-(3-methylphenyl)acetyl]phenyl]benzamide |
| SMILES | CCSc1ccccc1C(=O)Nc1ccccc1C(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C24H23NO2S/c1-3-28-23-14-7-5-12-20(23)24(27)25-21-13-6-4-11-19(21)22(26)16-18-10-8-9-17(2)15-18/h4-15H,3,16H2,1-2H3,(H,25,27) |
| InChIKey | DCHXWSTZMAHGCY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |