C22H15F3INO4S — CID 149040936
2-iodo-N-[2-[2-[3-(trifluoromethylsulfonyl)phenyl]acetyl]phenyl]benzamide (PubChem CID 149040936) has the molecular formula C22H15F3INO4S and a molecular weight of 573.33 g/mol. Its IUPAC name is 2-iodo-N-[2-[2-[3-(trifluoromethylsulfonyl)phenyl]acetyl]phenyl]benzamide.
| Compound Name | 2-iodo-N-[2-[2-[3-(trifluoromethylsulfonyl)phenyl]acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 149040936 |
| Molecular Formula | C22H15F3INO4S |
| Molecular Weight | 573.33 g/mol |
| Exact Mass | 572.97 |
| IUPAC Name | 2-iodo-N-[2-[2-[3-(trifluoromethylsulfonyl)phenyl]acetyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)Cc1cccc(S(=O)(=O)C(F)(F)F)c1)c1ccccc1I |
| InChI | InChI=1S/C22H15F3INO4S/c23-22(24,25)32(30,31)15-7-5-6-14(12-15)13-20(28)17-9-2-4-11-19(17)27-21(29)16-8-1-3-10-18(16)26/h1-12H,13H2,(H,27,29) |
| InChIKey | QHOLNEBGFUJVIN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|