C24H20F3NO4 — CID 162047234
2,6-dimethoxy-N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]benzamide (PubChem CID 162047234) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]benzamide |
|---|---|
| PubChem CID | 162047234 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2,6-dimethoxy-N-[2-[2-[3-(trifluoromethyl)phenyl]acetyl]phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccccc1C(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3NO4/c1-31-20-11-6-12-21(32-2)22(20)23(30)28-18-10-4-3-9-17(18)19(29)14-15-7-5-8-16(13-15)24(25,26)27/h3-13H,14H2,1-2H3,(H,28,30) |
| InChIKey | YYBCFINWDNJIDP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |