C17H15F3N2O4 — CID 108933413
2,6-dimethoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide (PubChem CID 108933413) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 2,6-dimethoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide.
| Compound Name | 2,6-dimethoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 108933413 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 2,6-dimethoxy-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]benzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H15F3N2O4/c1-25-12-8-5-9-13(26-2)14(12)15(23)21-10-6-3-4-7-11(10)22-16(24)17(18,19)20/h3-9H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | BOOZKULFODIWTA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |