C9H7BrF3NO2 — CID 156877036
N-(2-bromo-6-methoxyphenyl)-2,2,2-trifluoroacetamide (PubChem CID 156877036) has the molecular formula C9H7BrF3NO2 and a molecular weight of 298.06 g/mol. Its IUPAC name is N-(2-bromo-6-methoxyphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(2-bromo-6-methoxyphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 156877036 |
| Molecular Formula | C9H7BrF3NO2 |
| Molecular Weight | 298.06 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | N-(2-bromo-6-methoxyphenyl)-2,2,2-trifluoroacetamide |
| SMILES | COc1cccc(Br)c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7BrF3NO2/c1-16-6-4-2-3-5(10)7(6)14-8(15)9(11,12)13/h2-4H,1H3,(H,14,15) |
| InChIKey | WFCGDLKWIOSORH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.06 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |