C10H9BrF3NO2 — CID 63374766
N-[3-bromo-2-(methoxymethyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 63374766) has the molecular formula C10H9BrF3NO2 and a molecular weight of 312.09 g/mol. Its IUPAC name is N-[3-bromo-2-(methoxymethyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-bromo-2-(methoxymethyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 63374766 |
| Molecular Formula | C10H9BrF3NO2 |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | N-[3-bromo-2-(methoxymethyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | COCc1c(Br)cccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9BrF3NO2/c1-17-5-6-7(11)3-2-4-8(6)15-9(16)10(12,13)14/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | JQYLUMSYIVYWLX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |