C12H16BrN3O3 — CID 61167372
2-amino-N-[3-bromo-2-(methoxymethyl)phenyl]butanediamide (PubChem CID 61167372) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 2-amino-N-[3-bromo-2-(methoxymethyl)phenyl]butanediamide.
| Compound Name | 2-amino-N-[3-bromo-2-(methoxymethyl)phenyl]butanediamide |
|---|---|
| PubChem CID | 61167372 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 2-amino-N-[3-bromo-2-(methoxymethyl)phenyl]butanediamide |
| SMILES | COCc1c(Br)cccc1NC(=O)C(N)CC(N)=O |
| InChI | InChI=1S/C12H16BrN3O3/c1-19-6-7-8(13)3-2-4-10(7)16-12(18)9(14)5-11(15)17/h2-4,9H,5-6,14H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | ZQULBTNCWDAFEQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |