C12H15F3N2O4S — CID 135341197
2-amino-N-(2,6-dimethoxyphenyl)ethanethioamide;2,2,2-trifluoroacetic acid (PubChem CID 135341197) has the molecular formula C12H15F3N2O4S and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-amino-N-(2,6-dimethoxyphenyl)ethanethioamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-amino-N-(2,6-dimethoxyphenyl)ethanethioamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135341197 |
| Molecular Formula | C12H15F3N2O4S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-amino-N-(2,6-dimethoxyphenyl)ethanethioamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cccc(OC)c1NC(=S)CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H14N2O2S.C2HF3O2/c1-13-7-4-3-5-8(14-2)10(7)12-9(15)6-11;3-2(4,5)1(6)7/h3-5H,6,11H2,1-2H3,(H,12,15);(H,6,7) |
| InChIKey | SSBJAMHQNBBWGX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|