C14H12F3NO4 — CID 134541444
N-(2,6-dimethoxyphenyl)-5-(trifluoromethyl)furan-2-carboxamide (PubChem CID 134541444) has the molecular formula C14H12F3NO4 and a molecular weight of 315.25 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-5-(trifluoromethyl)furan-2-carboxamide.
| Compound Name | N-(2,6-dimethoxyphenyl)-5-(trifluoromethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 134541444 |
| Molecular Formula | C14H12F3NO4 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-5-(trifluoromethyl)furan-2-carboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)c1ccc(C(F)(F)F)o1 |
| InChI | InChI=1S/C14H12F3NO4/c1-20-8-4-3-5-9(21-2)12(8)18-13(19)10-6-7-11(22-10)14(15,16)17/h3-7H,1-2H3,(H,18,19) |
| InChIKey | FTFDFIQYTRROAI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |