C28H33NO5 — CID 10139658
N-(2,6-dimethoxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carboxamide (PubChem CID 10139658) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is N-(2,6-dimethoxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carboxamide.
| Compound Name | N-(2,6-dimethoxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 10139658 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-(2,6-dimethoxyphenyl)-5-[(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)oxy]furan-2-carboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)c1ccc(Oc2cc3c(cc2C)C(C)(C)CCC3(C)C)o1 |
| InChI | InChI=1S/C28H33NO5/c1-17-15-18-19(28(4,5)14-13-27(18,2)3)16-23(17)34-24-12-11-22(33-24)26(30)29-25-20(31-6)9-8-10-21(25)32-7/h8-12,15-16H,13-14H2,1-7H3,(H,29,30) |
| InChIKey | YDPRVCFOPMOPJK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |