C25H29NO6Si — CID 11294292
N-(2,4,6-trimethoxyphenyl)-5-[(1,1,5-trimethyl-2,3-dihydro-1-benzosilol-6-yl)oxy]furan-2-carboxamide (PubChem CID 11294292) has the molecular formula C25H29NO6Si and a molecular weight of 467.59 g/mol. Its IUPAC name is N-(2,4,6-trimethoxyphenyl)-5-[(1,1,5-trimethyl-2,3-dihydro-1-benzosilol-6-yl)oxy]furan-2-carboxamide.
| Compound Name | N-(2,4,6-trimethoxyphenyl)-5-[(1,1,5-trimethyl-2,3-dihydro-1-benzosilol-6-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 11294292 |
| Molecular Formula | C25H29NO6Si |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-(2,4,6-trimethoxyphenyl)-5-[(1,1,5-trimethyl-2,3-dihydro-1-benzosilol-6-yl)oxy]furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3cc4c(cc3C)CC[Si]4(C)C)o2)c(OC)c1 |
| InChI | InChI=1S/C25H29NO6Si/c1-15-11-16-9-10-33(5,6)22(16)14-19(15)32-23-8-7-18(31-23)25(27)26-24-20(29-3)12-17(28-2)13-21(24)30-4/h7-8,11-14H,9-10H2,1-6H3,(H,26,27) |
| InChIKey | GVEPRRABFLJKOI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|