C25H28N2O6 — CID 10182522
5-(3-piperidin-4-ylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide (PubChem CID 10182522) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-(3-piperidin-4-ylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide.
| Compound Name | 5-(3-piperidin-4-ylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 10182522 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 5-(3-piperidin-4-ylphenoxy)-N-(2,4,6-trimethoxyphenyl)furan-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(Oc3cccc(C4CCNCC4)c3)o2)c(OC)c1 |
| InChI | InChI=1S/C25H28N2O6/c1-29-19-14-21(30-2)24(22(15-19)31-3)27-25(28)20-7-8-23(33-20)32-18-6-4-5-17(13-18)16-9-11-26-12-10-16/h4-8,13-16,26H,9-12H2,1-3H3,(H,27,28) |
| InChIKey | CBMAERZJYMBWCP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |