C15H21N3O4 — CID 108868039
N-[(2,6-dimethoxyphenyl)carbamoyl]piperidine-4-carboxamide (PubChem CID 108868039) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)carbamoyl]piperidine-4-carboxamide.
| Compound Name | N-[(2,6-dimethoxyphenyl)carbamoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108868039 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)carbamoyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(OC)c1NC(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C15H21N3O4/c1-21-11-4-3-5-12(22-2)13(11)17-15(20)18-14(19)10-6-8-16-9-7-10/h3-5,10,16H,6-9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | DYBLIZYFOLCCIH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |