About N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide
N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide (PubChem CID 108892600) has the molecular formula C13H14F3N3O2
and a molecular weight of 301.27 g/mol. Its IUPAC name is N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide |
| PubChem CID | 108892600 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H14F3N3O2/c14-8-1-2-9(11(16)10(8)15)18-13(21)19-12(20)7-3-5-17-6-4-7/h1-2,7,17H,3-6H2,(H2,18,19,20,21) |
| InChIKey | IAHRXMNOKIKYFA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide?
The IUPAC name of N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide (CID 108892600) is N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide.
What is the SMILES notation for N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide?
The canonical SMILES for N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide is O=C(NC(=O)C1CCNCC1)Nc1ccc(F)c(F)c1F.
What is the InChIKey of N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide?
The InChIKey is IAHRXMNOKIKYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O2/c14-8-1-2-9(11(16)10(8)15)18-13(21)19-12(20)7-3-5-17-6-4-7/h1-2,7,17H,3-6H2,(H2,18,19,20,21).
What are the key properties of N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide?
N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide has a molecular weight of 301.27 g/mol, XLogP of 1.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,3,4-trifluorophenyl)carbamoyl]piperidine-4-carboxamide is sourced from PubChem (CID 108892600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).