C11H10F3NOS — CID 110865134
N-(2,3,4-trifluorophenyl)thiolane-2-carboxamide (PubChem CID 110865134) has the molecular formula C11H10F3NOS and a molecular weight of 261.27 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)thiolane-2-carboxamide.
| Compound Name | N-(2,3,4-trifluorophenyl)thiolane-2-carboxamide |
|---|---|
| PubChem CID | 110865134 |
| Molecular Formula | C11H10F3NOS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)thiolane-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)C1CCCS1 |
| InChI | InChI=1S/C11H10F3NOS/c12-6-3-4-7(10(14)9(6)13)15-11(16)8-2-1-5-17-8/h3-4,8H,1-2,5H2,(H,15,16) |
| InChIKey | RBBIJNXCLAIOES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|