C13H15F3N2O2 — CID 75948763
1-(2-hydroxycyclohexyl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 75948763) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 1-(2-hydroxycyclohexyl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(2-hydroxycyclohexyl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 75948763 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-(2-hydroxycyclohexyl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)NC1CCCCC1O |
| InChI | InChI=1S/C13H15F3N2O2/c14-7-5-6-9(12(16)11(7)15)18-13(20)17-8-3-1-2-4-10(8)19/h5-6,8,10,19H,1-4H2,(H2,17,18,20) |
| InChIKey | DDATVNQMBSEIBE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|