C11H11F3N2O2 — CID 113321934
1-(oxolan-3-yl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 113321934) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.21 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(oxolan-3-yl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 113321934 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(oxolan-3-yl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)NC1CCOC1 |
| InChI | InChI=1S/C11H11F3N2O2/c12-7-1-2-8(10(14)9(7)13)16-11(17)15-6-3-4-18-5-6/h1-2,6H,3-5H2,(H2,15,16,17) |
| InChIKey | MRERLOORGOYKIX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|