C13H16F3N3O — CID 47133044
1-(1-methylpiperidin-4-yl)-3-(2,3,4-trifluorophenyl)urea (PubChem CID 47133044) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-(1-methylpiperidin-4-yl)-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 47133044 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CN1CCC(NC(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C13H16F3N3O/c1-19-6-4-8(5-7-19)17-13(20)18-10-3-2-9(14)11(15)12(10)16/h2-3,8H,4-7H2,1H3,(H2,17,18,20) |
| InChIKey | QZVJFPZPPJEANO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|