C17H22F3N5O2 — CID 119133307
2-[[N-(1-acetylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 119133307) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[[N-(1-acetylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[N-(1-acetylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 119133307 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 2-[[N-(1-acetylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)c(F)c1F)NC1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C17H22F3N5O2/c1-10(26)25-7-5-11(6-8-25)23-17(21-2)22-9-14(27)24-13-4-3-12(18)15(19)16(13)20/h3-4,11H,5-9H2,1-2H3,(H,24,27)(H2,21,22,23) |
| InChIKey | XDDVPIOCMIKPDP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|